About 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine
9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine (PubChem CID 86016896) has the molecular formula C11H17N5O
and a molecular weight of 235.29 g/mol. Its IUPAC name is 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine.
Molecular Properties
| Compound Name | 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine |
| PubChem CID | 86016896 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine |
| SMILES | CCOC(C)n1cnc2c(N(C)C)ncnc21 |
| InChI | InChI=1S/C11H17N5O/c1-5-17-8(2)16-7-14-9-10(15(3)4)12-6-13-11(9)16/h6-8H,5H2,1-4H3 |
| InChIKey | JKEMXJUTBGTJNS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine?
The IUPAC name of 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine (CID 86016896) is 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine.
What is the SMILES notation for 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine?
The canonical SMILES for 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine is CCOC(C)n1cnc2c(N(C)C)ncnc21.
What is the InChIKey of 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine?
The InChIKey is JKEMXJUTBGTJNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O/c1-5-17-8(2)16-7-14-9-10(15(3)4)12-6-13-11(9)16/h6-8H,5H2,1-4H3.
What are the key properties of 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine?
9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine has a molecular weight of 235.29 g/mol, XLogP of 1.45, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine is sourced from PubChem (CID 86016896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).