C11H17N5O — CID 86016896
9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine (PubChem CID 86016896) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine.
| Compound Name | 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine |
|---|---|
| PubChem CID | 86016896 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 9-(1-ethoxyethyl)-N,N-dimethylpurin-6-amine |
| SMILES | CCOC(C)n1cnc2c(N(C)C)ncnc21 |
| InChI | InChI=1S/C11H17N5O/c1-5-17-8(2)16-7-14-9-10(15(3)4)12-6-13-11(9)16/h6-8H,5H2,1-4H3 |
| InChIKey | JKEMXJUTBGTJNS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |