C18H31N5 — CID 137470783
N,N-dimethyl-9-undecan-4-ylpurin-6-amine (PubChem CID 137470783) has the molecular formula C18H31N5 and a molecular weight of 317.48 g/mol. Its IUPAC name is N,N-dimethyl-9-undecan-4-ylpurin-6-amine.
| Compound Name | N,N-dimethyl-9-undecan-4-ylpurin-6-amine |
|---|---|
| PubChem CID | 137470783 |
| Molecular Formula | C18H31N5 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | N,N-dimethyl-9-undecan-4-ylpurin-6-amine |
| SMILES | CCCCCCCC(CCC)n1cnc2c(N(C)C)ncnc21 |
| InChI | InChI=1S/C18H31N5/c1-5-7-8-9-10-12-15(11-6-2)23-14-21-16-17(22(3)4)19-13-20-18(16)23/h13-15H,5-12H2,1-4H3 |
| InChIKey | PNHILCAIQCNJOE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|