C18H29N5O2S — CID 176574977
2-methylsulfanylethyl N-(9-nonan-5-ylpurin-6-yl)carbamate (PubChem CID 176574977) has the molecular formula C18H29N5O2S and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-methylsulfanylethyl N-(9-nonan-5-ylpurin-6-yl)carbamate.
| Compound Name | 2-methylsulfanylethyl N-(9-nonan-5-ylpurin-6-yl)carbamate |
|---|---|
| PubChem CID | 176574977 |
| Molecular Formula | C18H29N5O2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-methylsulfanylethyl N-(9-nonan-5-ylpurin-6-yl)carbamate |
| SMILES | CCCCC(CCCC)n1cnc2c(NC(=O)OCCSC)ncnc21 |
| InChI | InChI=1S/C18H29N5O2S/c1-4-6-8-14(9-7-5-2)23-13-21-15-16(19-12-20-17(15)23)22-18(24)25-10-11-26-3/h12-14H,4-11H2,1-3H3,(H,19,20,22,24) |
| InChIKey | ZYSJHAWOIPCFCE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|