C33H58N7O8P — CID 162724659
hexyl 2-[[[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]-[[(2R)-1-[6-(propoxycarbonylamino)purin-9-yl]propan-2-yl]oxymethyl]phosphoryl]amino]-2-methylpropanoate (PubChem CID 162724659) has the molecular formula C33H58N7O8P and a molecular weight of 711.84 g/mol. Its IUPAC name is hexyl 2-[[[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]-[[(2R)-1-[6-(propoxycarbonylamino)purin-9-yl]propan-2-yl]oxymethyl]phosphoryl]amino]-2-methylpropanoate.
| Compound Name | hexyl 2-[[[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]-[[(2R)-1-[6-(propoxycarbonylamino)purin-9-yl]propan-2-yl]oxymethyl]phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 162724659 |
| Molecular Formula | C33H58N7O8P |
| Molecular Weight | 711.84 g/mol |
| Exact Mass | 711.41 |
| IUPAC Name | hexyl 2-[[[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]-[[(2R)-1-[6-(propoxycarbonylamino)purin-9-yl]propan-2-yl]oxymethyl]phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCCOC(=O)C(C)(C)NP(=O)(CO[C@H](C)Cn1cnc2c(NC(=O)OCCC)ncnc21)NC(C)(C)C(=O)OCCCCCC |
| InChI | InChI=1S/C33H58N7O8P/c1-9-12-14-16-19-45-29(41)32(5,6)38-49(44,39-33(7,8)30(42)46-20-17-15-13-10-2)24-48-25(4)21-40-23-36-26-27(34-22-35-28(26)40)37-31(43)47-18-11-3/h22-23,25H,9-21,24H2,1-8H3,(H2,38,39,44)(H,34,35,37,43)/t25-/m1/s1 |
| InChIKey | FWXHUUSPHHUJNL-RUZDIDTESA-N |
| XLogP | 6.32 |
| TPSA | 184.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.84 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|