C37H58N7O13P — CID 167013847
2-[[9-[(2R)-2-[bis[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphorylmethoxy]propyl]purin-6-yl]carbamoyloxy]ethyl 5-methyl-2-oxo-1,3-dioxole-4-carboxylate (PubChem CID 167013847) has the molecular formula C37H58N7O13P and a molecular weight of 839.88 g/mol. Its IUPAC name is 2-[[9-[(2R)-2-[bis[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphorylmethoxy]propyl]purin-6-yl]carbamoyloxy]ethyl 5-methyl-2-oxo-1,3-dioxole-4-carboxylate.
| Compound Name | 2-[[9-[(2R)-2-[bis[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphorylmethoxy]propyl]purin-6-yl]carbamoyloxy]ethyl 5-methyl-2-oxo-1,3-dioxole-4-carboxylate |
|---|---|
| PubChem CID | 167013847 |
| Molecular Formula | C37H58N7O13P |
| Molecular Weight | 839.88 g/mol |
| Exact Mass | 839.38 |
| IUPAC Name | 2-[[9-[(2R)-2-[bis[(1-hexoxy-2-methyl-1-oxopropan-2-yl)amino]phosphorylmethoxy]propyl]purin-6-yl]carbamoyloxy]ethyl 5-methyl-2-oxo-1,3-dioxole-4-carboxylate |
| SMILES | CCCCCCOC(=O)C(C)(C)NP(=O)(CO[C@H](C)Cn1cnc2c(NC(=O)OCCOC(=O)c3oc(=O)oc3C)ncnc21)NC(C)(C)C(=O)OCCCCCC |
| InChI | InChI=1S/C37H58N7O13P/c1-9-11-13-15-17-52-32(46)36(5,6)42-58(50,43-37(7,8)33(47)53-18-16-14-12-10-2)24-55-25(3)21-44-23-40-27-29(38-22-39-30(27)44)41-34(48)54-20-19-51-31(45)28-26(4)56-35(49)57-28/h22-23,25H,9-21,24H2,1-8H3,(H2,42,43,50)(H,38,39,41,48)/t25-/m1/s1 |
| InChIKey | XPVCQOBLMMMFDZ-RUZDIDTESA-N |
| XLogP | 5.63 |
| TPSA | 254.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.88 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|