C8H8ClHgN5O2 — CID 140656280
chloro-[6-(ethoxycarbonylamino)purin-9-yl]mercury (PubChem CID 140656280) has the molecular formula C8H8ClHgN5O2 and a molecular weight of 442.23 g/mol. Its IUPAC name is chloro-[6-(ethoxycarbonylamino)purin-9-yl]mercury.
| Compound Name | chloro-[6-(ethoxycarbonylamino)purin-9-yl]mercury |
|---|---|
| PubChem CID | 140656280 |
| Molecular Formula | C8H8ClHgN5O2 |
| Molecular Weight | 442.23 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | chloro-[6-(ethoxycarbonylamino)purin-9-yl]mercury |
| SMILES | CCOC(=O)Nc1ncnc2c1ncn2[Hg]Cl |
| InChI | InChI=1S/C8H9N5O2.ClH.Hg/c1-2-15-8(14)13-7-5-6(10-3-9-5)11-4-12-7;;/h3-4H,2H2,1H3,(H2,9,10,11,12,13,14);1H;/q;;+2/p-2 |
| InChIKey | KTQYXXALKZNHCI-UHFFFAOYSA-L |
| XLogP | 1.39 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|