C12H11ClN4O2 — CID 54568616
[(1S)-2-[(6-chloropurin-9-yl)methylidene]cyclopropyl]methyl acetate (PubChem CID 54568616) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is [(1S)-2-[(6-chloropurin-9-yl)methylidene]cyclopropyl]methyl acetate.
| Compound Name | [(1S)-2-[(6-chloropurin-9-yl)methylidene]cyclopropyl]methyl acetate |
|---|---|
| PubChem CID | 54568616 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | [(1S)-2-[(6-chloropurin-9-yl)methylidene]cyclopropyl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC1=Cn1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C12H11ClN4O2/c1-7(18)19-4-9-2-8(9)3-17-6-16-10-11(13)14-5-15-12(10)17/h3,5-6,9H,2,4H2,1H3/t9-/m1/s1 |
| InChIKey | ZVPUPNKEXRXQOU-SECBINFHSA-N |
| XLogP | 1.90 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |