C14H17N5O3 — CID 139474417
[(2Z)-2-[(2-amino-6-oxo-1H-purin-9-yl)methylidene]cyclopropyl]methyl 2-methylpropanoate (PubChem CID 139474417) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is [(2Z)-2-[(2-amino-6-oxo-1H-purin-9-yl)methylidene]cyclopropyl]methyl 2-methylpropanoate.
| Compound Name | [(2Z)-2-[(2-amino-6-oxo-1H-purin-9-yl)methylidene]cyclopropyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 139474417 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | [(2Z)-2-[(2-amino-6-oxo-1H-purin-9-yl)methylidene]cyclopropyl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCC1C/C1=C/n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C14H17N5O3/c1-7(2)13(21)22-5-9-3-8(9)4-19-6-16-10-11(19)17-14(15)18-12(10)20/h4,6-7,9H,3,5H2,1-2H3,(H3,15,17,18,20)/b8-4- |
| InChIKey | QZRLQSAQFPXEDS-YWEYNIOJSA-N |
| XLogP | 0.76 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |