C19H26ClN5O4 — CID 123337833
tert-butyl N-[6-chloro-9-[1-(6-methyl-1,3-dioxan-4-yl)but-3-en-2-yl]purin-2-yl]carbamate (PubChem CID 123337833) has the molecular formula C19H26ClN5O4 and a molecular weight of 423.90 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-9-[1-(6-methyl-1,3-dioxan-4-yl)but-3-en-2-yl]purin-2-yl]carbamate.
| Compound Name | tert-butyl N-[6-chloro-9-[1-(6-methyl-1,3-dioxan-4-yl)but-3-en-2-yl]purin-2-yl]carbamate |
|---|---|
| PubChem CID | 123337833 |
| Molecular Formula | C19H26ClN5O4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | tert-butyl N-[6-chloro-9-[1-(6-methyl-1,3-dioxan-4-yl)but-3-en-2-yl]purin-2-yl]carbamate |
| SMILES | C=CC(CC1CC(C)OCO1)n1cnc2c(Cl)nc(NC(=O)OC(C)(C)C)nc21 |
| InChI | InChI=1S/C19H26ClN5O4/c1-6-12(8-13-7-11(2)27-10-28-13)25-9-21-14-15(20)22-17(23-16(14)25)24-18(26)29-19(3,4)5/h6,9,11-13H,1,7-8,10H2,2-5H3,(H,22,23,24,26) |
| InChIKey | JFEIZPQPNQFGRP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|