C19H27ClN5O7P — CID 144963159
methyl 2-[(Z)-4-[6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]but-2-enoxy]-2-dimethoxyphosphanylacetate (PubChem CID 144963159) has the molecular formula C19H27ClN5O7P and a molecular weight of 503.88 g/mol. Its IUPAC name is methyl 2-[(Z)-4-[6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]but-2-enoxy]-2-dimethoxyphosphanylacetate.
| Compound Name | methyl 2-[(Z)-4-[6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]but-2-enoxy]-2-dimethoxyphosphanylacetate |
|---|---|
| PubChem CID | 144963159 |
| Molecular Formula | C19H27ClN5O7P |
| Molecular Weight | 503.88 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | methyl 2-[(Z)-4-[6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]but-2-enoxy]-2-dimethoxyphosphanylacetate |
| SMILES | COC(=O)C(OC/C=C\Cn1cnc2c(Cl)nc(NC(=O)OC(C)(C)C)nc21)P(OC)OC |
| InChI | InChI=1S/C19H27ClN5O7P/c1-19(2,3)32-18(27)24-17-22-13(20)12-14(23-17)25(11-21-12)9-7-8-10-31-16(15(26)28-4)33(29-5)30-6/h7-8,11,16H,9-10H2,1-6H3,(H,22,23,24,27)/b8-7- |
| InChIKey | QQJHBLSOYLPBTR-FPLPWBNLSA-N |
| XLogP | 3.50 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.88 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|