C16H25N7O4 — CID 66743097
ethyl 2-[6-amino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]purin-9-yl]acetate (PubChem CID 66743097) has the molecular formula C16H25N7O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is ethyl 2-[6-amino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]purin-9-yl]acetate.
| Compound Name | ethyl 2-[6-amino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]purin-9-yl]acetate |
|---|---|
| PubChem CID | 66743097 |
| Molecular Formula | C16H25N7O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | ethyl 2-[6-amino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]purin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(N)nc(NCCNC(=O)OC(C)(C)C)nc21 |
| InChI | InChI=1S/C16H25N7O4/c1-5-26-10(24)8-23-9-20-11-12(17)21-14(22-13(11)23)18-6-7-19-15(25)27-16(2,3)4/h9H,5-8H2,1-4H3,(H,19,25)(H3,17,18,21,22) |
| InChIKey | WDRQVRRMNQQQER-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|