C23H38N8O6 — CID 178038466
2-[2,6-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]purin-9-yl]acetic acid (PubChem CID 178038466) has the molecular formula C23H38N8O6 and a molecular weight of 522.61 g/mol. Its IUPAC name is 2-[2,6-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]purin-9-yl]acetic acid.
| Compound Name | 2-[2,6-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 178038466 |
| Molecular Formula | C23H38N8O6 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 2-[2,6-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]purin-9-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCCNc1nc(NCCCNC(=O)OC(C)(C)C)c2ncn(CC(=O)O)c2n1 |
| InChI | InChI=1S/C23H38N8O6/c1-22(2,3)36-20(34)26-11-7-9-24-17-16-18(31(14-28-16)13-15(32)33)30-19(29-17)25-10-8-12-27-21(35)37-23(4,5)6/h14H,7-13H2,1-6H3,(H,26,34)(H,27,35)(H,32,33)(H2,24,25,29,30) |
| InChIKey | FHIKIBPQFDTUIH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|