C28H29N7O6 — CID 58354116
2-[6-(phenylmethoxycarbonylamino)-2-[[(4Z)-4-phenylmethoxycarbonyliminopentyl]amino]purin-9-yl]acetic acid (PubChem CID 58354116) has the molecular formula C28H29N7O6 and a molecular weight of 559.58 g/mol. Its IUPAC name is 2-[6-(phenylmethoxycarbonylamino)-2-[[(4Z)-4-phenylmethoxycarbonyliminopentyl]amino]purin-9-yl]acetic acid.
| Compound Name | 2-[6-(phenylmethoxycarbonylamino)-2-[[(4Z)-4-phenylmethoxycarbonyliminopentyl]amino]purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 58354116 |
| Molecular Formula | C28H29N7O6 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 2-[6-(phenylmethoxycarbonylamino)-2-[[(4Z)-4-phenylmethoxycarbonyliminopentyl]amino]purin-9-yl]acetic acid |
| SMILES | C/C(CCCNc1nc(NC(=O)OCc2ccccc2)c2ncn(CC(=O)O)c2n1)=N/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H29N7O6/c1-19(31-27(38)40-16-20-10-4-2-5-11-20)9-8-14-29-26-32-24(23-25(34-26)35(18-30-23)15-22(36)37)33-28(39)41-17-21-12-6-3-7-13-21/h2-7,10-13,18H,8-9,14-17H2,1H3,(H,36,37)(H2,29,32,33,34,39)/b31-19- |
| InChIKey | AQQZGWYHAUFTCK-DXJNIWACSA-N |
| XLogP | 4.65 |
| TPSA | 169.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|