C26H32N6O7 — CID 160752179
2-[[5-[(2-methylpropan-2-yl)oxy]-5-oxopentyl]-[2-[6-(phenylmethoxycarbonylamino)purin-9-yl]acetyl]amino]acetic acid (PubChem CID 160752179) has the molecular formula C26H32N6O7 and a molecular weight of 540.58 g/mol. Its IUPAC name is 2-[[5-[(2-methylpropan-2-yl)oxy]-5-oxopentyl]-[2-[6-(phenylmethoxycarbonylamino)purin-9-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[[5-[(2-methylpropan-2-yl)oxy]-5-oxopentyl]-[2-[6-(phenylmethoxycarbonylamino)purin-9-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 160752179 |
| Molecular Formula | C26H32N6O7 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-[[5-[(2-methylpropan-2-yl)oxy]-5-oxopentyl]-[2-[6-(phenylmethoxycarbonylamino)purin-9-yl]acetyl]amino]acetic acid |
| SMILES | CC(C)(C)OC(=O)CCCCN(CC(=O)O)C(=O)Cn1cnc2c(NC(=O)OCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C26H32N6O7/c1-26(2,3)39-21(36)11-7-8-12-31(14-20(34)35)19(33)13-32-17-29-22-23(27-16-28-24(22)32)30-25(37)38-15-18-9-5-4-6-10-18/h4-6,9-10,16-17H,7-8,11-15H2,1-3H3,(H,34,35)(H,27,28,30,37) |
| InChIKey | WZGAYUKMJGFBMV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 165.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|