C25H26N8O3 — CID 167063820
ethyl 2-[2-[2-(4-hydroxyanilino)ethylamino]-6-(2-methylbenzimidazol-1-yl)purin-9-yl]acetate (PubChem CID 167063820) has the molecular formula C25H26N8O3 and a molecular weight of 486.54 g/mol. Its IUPAC name is ethyl 2-[2-[2-(4-hydroxyanilino)ethylamino]-6-(2-methylbenzimidazol-1-yl)purin-9-yl]acetate.
| Compound Name | ethyl 2-[2-[2-(4-hydroxyanilino)ethylamino]-6-(2-methylbenzimidazol-1-yl)purin-9-yl]acetate |
|---|---|
| PubChem CID | 167063820 |
| Molecular Formula | C25H26N8O3 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | ethyl 2-[2-[2-(4-hydroxyanilino)ethylamino]-6-(2-methylbenzimidazol-1-yl)purin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(-n3c(C)nc4ccccc43)nc(NCCNc3ccc(O)cc3)nc21 |
| InChI | InChI=1S/C25H26N8O3/c1-3-36-21(35)14-32-15-28-22-23(32)30-25(27-13-12-26-17-8-10-18(34)11-9-17)31-24(22)33-16(2)29-19-6-4-5-7-20(19)33/h4-11,15,26,34H,3,12-14H2,1-2H3,(H,27,30,31) |
| InChIKey | VHUQIMLQLOABCT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|