C19H17ClN6O4 — CID 155102965
ethyl 1-[2-chloro-9-(2-ethoxy-2-oxoethyl)purin-6-yl]indazole-3-carboxylate (PubChem CID 155102965) has the molecular formula C19H17ClN6O4 and a molecular weight of 428.84 g/mol. Its IUPAC name is ethyl 1-[2-chloro-9-(2-ethoxy-2-oxoethyl)purin-6-yl]indazole-3-carboxylate.
| Compound Name | ethyl 1-[2-chloro-9-(2-ethoxy-2-oxoethyl)purin-6-yl]indazole-3-carboxylate |
|---|---|
| PubChem CID | 155102965 |
| Molecular Formula | C19H17ClN6O4 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | ethyl 1-[2-chloro-9-(2-ethoxy-2-oxoethyl)purin-6-yl]indazole-3-carboxylate |
| SMILES | CCOC(=O)Cn1cnc2c(-n3nc(C(=O)OCC)c4ccccc43)nc(Cl)nc21 |
| InChI | InChI=1S/C19H17ClN6O4/c1-3-29-13(27)9-25-10-21-15-16(25)22-19(20)23-17(15)26-12-8-6-5-7-11(12)14(24-26)18(28)30-4-2/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | LEMAVIIKCORKEL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |