C23H33ClN6O5 — CID 159569390
tert-butyl N-[(2R,3R,4R,5R)-5-[6-chloro-2-(2-methylpropanoylamino)purin-9-yl]-2-ethyl-4-prop-2-enoxyoxolan-3-yl]carbamate (PubChem CID 159569390) has the molecular formula C23H33ClN6O5 and a molecular weight of 509.01 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4R,5R)-5-[6-chloro-2-(2-methylpropanoylamino)purin-9-yl]-2-ethyl-4-prop-2-enoxyoxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,4R,5R)-5-[6-chloro-2-(2-methylpropanoylamino)purin-9-yl]-2-ethyl-4-prop-2-enoxyoxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 159569390 |
| Molecular Formula | C23H33ClN6O5 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | tert-butyl N-[(2R,3R,4R,5R)-5-[6-chloro-2-(2-methylpropanoylamino)purin-9-yl]-2-ethyl-4-prop-2-enoxyoxolan-3-yl]carbamate |
| SMILES | C=CCO[C@@H]1[C@H](NC(=O)OC(C)(C)C)[C@@H](CC)O[C@H]1n1cnc2c(Cl)nc(NC(=O)C(C)C)nc21 |
| InChI | InChI=1S/C23H33ClN6O5/c1-8-10-33-16-14(26-22(32)35-23(5,6)7)13(9-2)34-20(16)30-11-25-15-17(24)27-21(28-18(15)30)29-19(31)12(3)4/h8,11-14,16,20H,1,9-10H2,2-7H3,(H,26,32)(H,27,28,29,31)/t13-,14-,16-,20-/m1/s1 |
| InChIKey | AGXJURYZHGZPRZ-NOAAKOMESA-N |
| XLogP | 3.85 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|