C27H44N6O6Si — CID 91154402
N-[9-[(4aR,7R,7aR)-2,2-ditert-butyl-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-2-(2-methylpropanoylamino)purin-6-yl]-2-methylpropanamide (PubChem CID 91154402) has the molecular formula C27H44N6O6Si and a molecular weight of 576.77 g/mol. Its IUPAC name is N-[9-[(4aR,7R,7aR)-2,2-ditert-butyl-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-2-(2-methylpropanoylamino)purin-6-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(4aR,7R,7aR)-2,2-ditert-butyl-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-2-(2-methylpropanoylamino)purin-6-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 91154402 |
| Molecular Formula | C27H44N6O6Si |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | N-[9-[(4aR,7R,7aR)-2,2-ditert-butyl-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-6-yl]-2-(2-methylpropanoylamino)purin-6-yl]-2-methylpropanamide |
| SMILES | CO[C@H]1C(n2cnc3c(NC(=O)C(C)C)nc(NC(=O)C(C)C)nc32)O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]21 |
| InChI | InChI=1S/C27H44N6O6Si/c1-14(2)22(34)29-20-17-21(31-25(30-20)32-23(35)15(3)4)33(13-28-17)24-19(36-11)18-16(38-24)12-37-40(39-18,26(5,6)7)27(8,9)10/h13-16,18-19,24H,12H2,1-11H3,(H2,29,30,31,32,34,35)/t16-,18-,19-,24?/m1/s1 |
| InChIKey | GKIHSCUBEWTNHP-CDWWFMOKSA-N |
| XLogP | 4.39 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|