C25H42N4O6Si2 — CID 70799502
[(4aR,7R,7aR)-2,2-ditert-butyl-6-[6-(2-trimethylsilylethoxy)purin-9-yl]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl] acetate (PubChem CID 70799502) has the molecular formula C25H42N4O6Si2 and a molecular weight of 550.81 g/mol. Its IUPAC name is [(4aR,7R,7aR)-2,2-ditert-butyl-6-[6-(2-trimethylsilylethoxy)purin-9-yl]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl] acetate.
| Compound Name | [(4aR,7R,7aR)-2,2-ditert-butyl-6-[6-(2-trimethylsilylethoxy)purin-9-yl]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl] acetate |
|---|---|
| PubChem CID | 70799502 |
| Molecular Formula | C25H42N4O6Si2 |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | [(4aR,7R,7aR)-2,2-ditert-butyl-6-[6-(2-trimethylsilylethoxy)purin-9-yl]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(n2cnc3c(OCC[Si](C)(C)C)ncnc32)O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]21 |
| InChI | InChI=1S/C25H42N4O6Si2/c1-16(30)33-20-19-17(13-32-37(35-19,24(2,3)4)25(5,6)7)34-23(20)29-15-28-18-21(29)26-14-27-22(18)31-11-12-36(8,9)10/h14-15,17,19-20,23H,11-13H2,1-10H3/t17-,19-,20-,23?/m1/s1 |
| InChIKey | IEEWPJLLACWTLE-PSBUXNCMSA-N |
| XLogP | 4.83 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|