C36H50N4O4Si2 — CID 154335342
[(4aR,6R,7R,7aR)-2,2-ditert-butyl-6-[6-(3-phenylphenyl)purin-9-yl]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 154335342) has the molecular formula C36H50N4O4Si2 and a molecular weight of 658.99 g/mol. Its IUPAC name is [(4aR,6R,7R,7aR)-2,2-ditert-butyl-6-[6-(3-phenylphenyl)purin-9-yl]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aR,6R,7R,7aR)-2,2-ditert-butyl-6-[6-(3-phenylphenyl)purin-9-yl]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 154335342 |
| Molecular Formula | C36H50N4O4Si2 |
| Molecular Weight | 658.99 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | [(4aR,6R,7R,7aR)-2,2-ditert-butyl-6-[6-(3-phenylphenyl)purin-9-yl]-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H]2O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]2O[C@H]1n1cnc2c(-c3cccc(-c4ccccc4)c3)ncnc21 |
| InChI | InChI=1S/C36H50N4O4Si2/c1-34(2,3)45(10,11)43-31-30-27(21-41-46(44-30,35(4,5)6)36(7,8)9)42-33(31)40-23-39-29-28(37-22-38-32(29)40)26-19-15-18-25(20-26)24-16-13-12-14-17-24/h12-20,22-23,27,30-31,33H,21H2,1-11H3/t27-,30-,31-,33-/m1/s1 |
| InChIKey | NMVTVTTZDAMCMC-UGUWQOMFSA-N |
| XLogP | 8.91 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.99 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|