C33H54N6O5Si2 — CID 136832909
9-[(6aR,8R,9R,9aS)-9-(benzyl(15N)amino)-2,2,4,4-tetratert-butyl-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-amino-1H-purin-6-one (PubChem CID 136832909) has the molecular formula C33H54N6O5Si2 and a molecular weight of 672.00 g/mol. Its IUPAC name is 9-[(6aR,8R,9R,9aS)-9-(benzyl(15N)amino)-2,2,4,4-tetratert-butyl-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-amino-1H-purin-6-one.
| Compound Name | 9-[(6aR,8R,9R,9aS)-9-(benzyl(15N)amino)-2,2,4,4-tetratert-butyl-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-amino-1H-purin-6-one |
|---|---|
| PubChem CID | 136832909 |
| Molecular Formula | C33H54N6O5Si2 |
| Molecular Weight | 672.00 g/mol |
| Exact Mass | 671.37 |
| IUPAC Name | 9-[(6aR,8R,9R,9aS)-9-(benzyl(15N)amino)-2,2,4,4-tetratert-butyl-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-amino-1H-purin-6-one |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)[C@H]([15NH]Cc3ccccc3)[C@@H]2O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C33H54N6O5Si2/c1-30(2,3)45(31(4,5)6)41-19-22-25(43-46(44-45,32(7,8)9)33(10,11)12)23(35-18-21-16-14-13-15-17-21)28(42-22)39-20-36-24-26(39)37-29(34)38-27(24)40/h13-17,20,22-23,25,28,35H,18-19H2,1-12H3,(H3,34,37,38,40)/t22-,23-,25-,28-/m1/s1/i35+1 |
| InChIKey | UOZRQFSIQFFTJO-JHBCJKAMSA-N |
| XLogP | 6.27 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.00 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|