C18H21N5O4 — CID 169190541
2-amino-9-[(5S)-3-hydroxy-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 169190541) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-amino-9-[(5S)-3-hydroxy-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(5S)-3-hydroxy-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 169190541 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-amino-9-[(5S)-3-hydroxy-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | C[C@@]1(COCc2ccccc2)CC(O)C(n2cnc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C18H21N5O4/c1-18(9-26-8-11-5-3-2-4-6-11)7-12(24)16(27-18)23-10-20-13-14(23)21-17(19)22-15(13)25/h2-6,10,12,16,24H,7-9H2,1H3,(H3,19,21,22,25)/t12?,16?,18-/m0/s1 |
| InChIKey | VWIKRIDJEILERG-JIJFEZTESA-N |
| XLogP | 0.96 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |