C24H23ClFN5O4 — CID 171572641
2-amino-9-[(2R,3S,4R,5R)-3-chloro-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 171572641) has the molecular formula C24H23ClFN5O4 and a molecular weight of 499.93 g/mol. Its IUPAC name is 2-amino-9-[(2R,3S,4R,5R)-3-chloro-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3S,4R,5R)-3-chloro-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 171572641 |
| Molecular Formula | C24H23ClFN5O4 |
| Molecular Weight | 499.93 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 2-amino-9-[(2R,3S,4R,5R)-3-chloro-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@]2(F)Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C24H23ClFN5O4/c25-24(26)19(34-12-16-9-5-2-6-10-16)17(13-33-11-15-7-3-1-4-8-15)35-22(24)31-14-28-18-20(31)29-23(27)30-21(18)32/h1-10,14,17,19,22H,11-13H2,(H3,27,29,30,32)/t17-,19-,22-,24-/m1/s1 |
| InChIKey | ZCVMENFCLQTVCG-PDKZGUECSA-N |
| XLogP | 3.31 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.93 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|