C25H27N5O3 — CID 135599081
2-amino-9-[2,4-bis(phenylmethoxy)cyclohexyl]-1H-purin-6-one (PubChem CID 135599081) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-amino-9-[2,4-bis(phenylmethoxy)cyclohexyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2,4-bis(phenylmethoxy)cyclohexyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135599081 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-amino-9-[2,4-bis(phenylmethoxy)cyclohexyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2CCC(OCc3ccccc3)CC2OCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C25H27N5O3/c26-25-28-23-22(24(31)29-25)27-16-30(23)20-12-11-19(32-14-17-7-3-1-4-8-17)13-21(20)33-15-18-9-5-2-6-10-18/h1-10,16,19-21H,11-15H2,(H3,26,28,29,31) |
| InChIKey | DPHFGSUXRWNQAY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |