C17H19N5O5 — CID 135409561
2-amino-9-[(2-phenylmethoxy-1,3-dioxan-5-yl)oxymethyl]-1H-purin-6-one (PubChem CID 135409561) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-amino-9-[(2-phenylmethoxy-1,3-dioxan-5-yl)oxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2-phenylmethoxy-1,3-dioxan-5-yl)oxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135409561 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-amino-9-[(2-phenylmethoxy-1,3-dioxan-5-yl)oxymethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2COC2COC(OCc3ccccc3)OC2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H19N5O5/c18-16-20-14-13(15(23)21-16)19-9-22(14)10-27-12-7-25-17(26-8-12)24-6-11-4-2-1-3-5-11/h1-5,9,12,17H,6-8,10H2,(H3,18,20,21,23) |
| InChIKey | GCODFJDGLSJGOG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |