C22H31N5O4 — CID 135745171
2-amino-9-[(1-hexoxy-3-phenylmethoxypropan-2-yl)oxymethyl]-1H-purin-6-one (PubChem CID 135745171) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-amino-9-[(1-hexoxy-3-phenylmethoxypropan-2-yl)oxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1-hexoxy-3-phenylmethoxypropan-2-yl)oxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135745171 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-amino-9-[(1-hexoxy-3-phenylmethoxypropan-2-yl)oxymethyl]-1H-purin-6-one |
| SMILES | CCCCCCOCC(COCc1ccccc1)OCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C22H31N5O4/c1-2-3-4-8-11-29-13-18(14-30-12-17-9-6-5-7-10-17)31-16-27-15-24-19-20(27)25-22(23)26-21(19)28/h5-7,9-10,15,18H,2-4,8,11-14,16H2,1H3,(H3,23,25,26,28) |
| InChIKey | HDZQODJRRDNPEB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|