C9H13N5O9P2-2 — CID 135446834
[5-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,3,2-dioxaphosphinan-2-yl] dihydrogen phosphate;oxygen(2-) (PubChem CID 135446834) has the molecular formula C9H13N5O9P2-2 and a molecular weight of 397.18 g/mol. Its IUPAC name is [5-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,3,2-dioxaphosphinan-2-yl] dihydrogen phosphate;oxygen(2-).
| Compound Name | [5-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,3,2-dioxaphosphinan-2-yl] dihydrogen phosphate;oxygen(2-) |
|---|---|
| PubChem CID | 135446834 |
| Molecular Formula | C9H13N5O9P2-2 |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | [5-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,3,2-dioxaphosphinan-2-yl] dihydrogen phosphate;oxygen(2-) |
| SMILES | Nc1nc2c(ncn2COC2COP(OP(=O)(O)O)OC2)c(=O)[nH]1.[O-2] |
| InChI | InChI=1S/C9H13N5O8P2.O/c10-9-12-7-6(8(15)13-9)11-3-14(7)4-19-5-1-20-23(21-2-5)22-24(16,17)18;/h3,5H,1-2,4H2,(H2,16,17,18)(H3,10,12,13,15);/q;-2 |
| InChIKey | KSPXAUKMFARPHN-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 212.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|