C18H19N5O2 — CID 135436161
2-amino-9-[(1R,4S)-4-benzyl-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one (PubChem CID 135436161) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-amino-9-[(1R,4S)-4-benzyl-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R,4S)-4-benzyl-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135436161 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-amino-9-[(1R,4S)-4-benzyl-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2C=C[C@](CO)(Cc3ccccc3)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H19N5O2/c19-17-21-15-14(16(25)22-17)20-11-23(15)13-6-7-18(9-13,10-24)8-12-4-2-1-3-5-12/h1-7,11,13,24H,8-10H2,(H3,19,21,22,25)/t13-,18-/m0/s1 |
| InChIKey | UDDXRQDNCBPPIA-UGSOOPFHSA-N |
| XLogP | 1.42 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|