C28H27N5O5 — CID 172874177
[3-(2-amino-6-oxo-1H-purin-9-yl)-2-methylidene-5-(2-phenylacetyl)oxycyclopentyl]methyl 2-phenylacetate (PubChem CID 172874177) has the molecular formula C28H27N5O5 and a molecular weight of 513.55 g/mol. Its IUPAC name is [3-(2-amino-6-oxo-1H-purin-9-yl)-2-methylidene-5-(2-phenylacetyl)oxycyclopentyl]methyl 2-phenylacetate.
| Compound Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-2-methylidene-5-(2-phenylacetyl)oxycyclopentyl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 172874177 |
| Molecular Formula | C28H27N5O5 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-2-methylidene-5-(2-phenylacetyl)oxycyclopentyl]methyl 2-phenylacetate |
| SMILES | C=C1C(COC(=O)Cc2ccccc2)C(OC(=O)Cc2ccccc2)CC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C28H27N5O5/c1-17-20(15-37-23(34)12-18-8-4-2-5-9-18)22(38-24(35)13-19-10-6-3-7-11-19)14-21(17)33-16-30-25-26(33)31-28(29)32-27(25)36/h2-11,16,20-22H,1,12-15H2,(H3,29,31,32,36) |
| InChIKey | ZPRIVAUSCFSMBF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|