C12H14IN5O3 — CID 137160203
[(1R,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methyl hypoiodite (PubChem CID 137160203) has the molecular formula C12H14IN5O3 and a molecular weight of 403.18 g/mol. Its IUPAC name is [(1R,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methyl hypoiodite.
| Compound Name | [(1R,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methyl hypoiodite |
|---|---|
| PubChem CID | 137160203 |
| Molecular Formula | C12H14IN5O3 |
| Molecular Weight | 403.18 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | [(1R,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methyl hypoiodite |
| SMILES | C=C1[C@H](COI)[C@@H](O)C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C12H14IN5O3/c1-5-6(3-21-13)8(19)2-7(5)18-4-15-9-10(18)16-12(14)17-11(9)20/h4,6-8,19H,1-3H2,(H3,14,16,17,20)/t6-,7-,8-/m0/s1 |
| InChIKey | HTPLNWCKVASEHQ-FXQIFTODSA-N |
| XLogP | 0.55 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|