C16H16FN5O6 — CID 135980239
[(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-4-fluorooxolan-2-yl]methyl acetate (PubChem CID 135980239) has the molecular formula C16H16FN5O6 and a molecular weight of 393.33 g/mol. Its IUPAC name is [(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-4-fluorooxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-4-fluorooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135980239 |
| Molecular Formula | C16H16FN5O6 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [(2R,3S,5R)-3-acetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-4-fluorooxolan-2-yl]methyl acetate |
| SMILES | C#CC1(F)[C@@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C16H16FN5O6/c1-4-16(17)11(27-8(3)24)9(5-26-7(2)23)28-14(16)22-6-19-10-12(22)20-15(18)21-13(10)25/h1,6,9,11,14H,5H2,2-3H3,(H3,18,20,21,25)/t9-,11+,14-,16?/m1/s1 |
| InChIKey | VHEOAVJEUYOOCA-OTPNLDJCSA-N |
| XLogP | -0.56 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|