C10H16N6O11P2 — CID 136593645
[(2R,3R,4R,5R)-4-amino-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 136593645) has the molecular formula C10H16N6O11P2 and a molecular weight of 458.22 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-amino-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-4-amino-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 136593645 |
| Molecular Formula | C10H16N6O11P2 |
| Molecular Weight | 458.22 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | [(2R,3R,4R,5R)-4-amino-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@]2(N)O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N6O11P2/c11-9-14-6-4(7(17)15-9)13-2-16(6)8-10(12,18)5(27-29(22,23)24)3(26-8)1-25-28(19,20)21/h2-3,5,8,18H,1,12H2,(H2,19,20,21)(H2,22,23,24)(H3,11,14,15,17)/t3-,5-,8-,10-/m1/s1 |
| InChIKey | JIZKUMSEDCKXGO-AEHJODJJSA-N |
| XLogP | -3.17 |
| TPSA | 278.59 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.22 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|