C10H13FN5O7PS — CID 162360739
[(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-3-hydroxy-4-sulfanyloxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 162360739) has the molecular formula C10H13FN5O7PS and a molecular weight of 397.28 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-3-hydroxy-4-sulfanyloxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-3-hydroxy-4-sulfanyloxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 162360739 |
| Molecular Formula | C10H13FN5O7PS |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-3-hydroxy-4-sulfanyloxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)O)[C@](O)(F)[C@H]2S)c(=O)[nH]1 |
| InChI | InChI=1S/C10H13FN5O7PS/c11-10(18)3(1-22-24(19,20)21)23-8(5(10)25)16-2-13-4-6(16)14-9(12)15-7(4)17/h2-3,5,8,18,25H,1H2,(H2,19,20,21)(H3,12,14,15,17)/t3-,5+,8-,10-/m1/s1 |
| InChIKey | UTUVXFGMMJEJCI-HVDHTTBBSA-N |
| XLogP | -1.34 |
| TPSA | 185.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|