C13H20N5O8P — CID 169308653
[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-(ethoxymethyl)-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 169308653) has the molecular formula C13H20N5O8P and a molecular weight of 405.30 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-(ethoxymethyl)-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-(ethoxymethyl)-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 169308653 |
| Molecular Formula | C13H20N5O8P |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-(ethoxymethyl)-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCOC[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C13H20N5O8P/c1-2-24-3-6-7(4-25-27(21,22)23)26-12(9(6)19)18-5-15-8-10(18)16-13(14)17-11(8)20/h5-7,9,12,19H,2-4H2,1H3,(H2,21,22,23)(H3,14,16,17,20)/t6-,7-,9-,12-/m1/s1 |
| InChIKey | NKKRICSFUGPKRP-GRIPGOBMSA-N |
| XLogP | -1.28 |
| TPSA | 195.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|