C18H29N6O8P — CID 169308951
[(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[2-(hexylamino)-2-oxoethyl]-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 169308951) has the molecular formula C18H29N6O8P and a molecular weight of 488.44 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[2-(hexylamino)-2-oxoethyl]-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[2-(hexylamino)-2-oxoethyl]-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 169308951 |
| Molecular Formula | C18H29N6O8P |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[2-(hexylamino)-2-oxoethyl]-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCCCCCNC(=O)C[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C18H29N6O8P/c1-2-3-4-5-6-20-12(25)7-10-11(8-31-33(28,29)30)32-17(14(10)26)24-9-21-13-15(24)22-18(19)23-16(13)27/h9-11,14,17,26H,2-8H2,1H3,(H,20,25)(H2,28,29,30)(H3,19,22,23,27)/t10-,11-,14-,17-/m1/s1 |
| InChIKey | NXCKSJNCICXJAX-HVLAWGQMSA-N |
| XLogP | -0.23 |
| TPSA | 214.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|