C11H17N6O6P — CID 137179272
[6-(2-amino-6-oxo-1H-purin-9-yl)-4-methylmorpholin-2-yl]methyl dihydrogen phosphate (PubChem CID 137179272) has the molecular formula C11H17N6O6P and a molecular weight of 360.27 g/mol. Its IUPAC name is [6-(2-amino-6-oxo-1H-purin-9-yl)-4-methylmorpholin-2-yl]methyl dihydrogen phosphate.
| Compound Name | [6-(2-amino-6-oxo-1H-purin-9-yl)-4-methylmorpholin-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137179272 |
| Molecular Formula | C11H17N6O6P |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [6-(2-amino-6-oxo-1H-purin-9-yl)-4-methylmorpholin-2-yl]methyl dihydrogen phosphate |
| SMILES | CN1CC(COP(=O)(O)O)OC(n2cnc3c(=O)[nH]c(N)nc32)C1 |
| InChI | InChI=1S/C11H17N6O6P/c1-16-2-6(4-22-24(19,20)21)23-7(3-16)17-5-13-8-9(17)14-11(12)15-10(8)18/h5-7H,2-4H2,1H3,(H2,19,20,21)(H3,12,14,15,18) |
| InChIKey | PIQFBIJPEGXEFL-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|