C12H11F2N5O4 — CID 136981818
2-amino-9-[(2R,3S,4S,5S)-3-ethynyl-4,5-difluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 136981818) has the molecular formula C12H11F2N5O4 and a molecular weight of 327.25 g/mol. Its IUPAC name is 2-amino-9-[(2R,3S,4S,5S)-3-ethynyl-4,5-difluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3S,4S,5S)-3-ethynyl-4,5-difluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136981818 |
| Molecular Formula | C12H11F2N5O4 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-amino-9-[(2R,3S,4S,5S)-3-ethynyl-4,5-difluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | C#C[C@]1(O)[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@](F)(CO)[C@H]1F |
| InChI | InChI=1S/C12H11F2N5O4/c1-2-11(22)8(13)12(14,3-20)23-9(11)19-4-16-5-6(19)17-10(15)18-7(5)21/h1,4,8-9,20,22H,3H2,(H3,15,17,18,21)/t8-,9+,11+,12+/m0/s1 |
| InChIKey | WIVILLGBLNXBTC-LUTQBAROSA-N |
| XLogP | -1.41 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|