C13H13FN4O5 — CID 136506722
9-[(2R,3R,4S,5S)-3-ethynyl-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methyl-1H-purin-6-one (PubChem CID 136506722) has the molecular formula C13H13FN4O5 and a molecular weight of 324.27 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5S)-3-ethynyl-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methyl-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S,5S)-3-ethynyl-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methyl-1H-purin-6-one |
|---|---|
| PubChem CID | 136506722 |
| Molecular Formula | C13H13FN4O5 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 9-[(2R,3R,4S,5S)-3-ethynyl-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methyl-1H-purin-6-one |
| SMILES | C#C[C@]1(O)[C@H](n2cnc3c(=O)[nH]c(C)nc32)O[C@](F)(CO)[C@H]1O |
| InChI | InChI=1S/C13H13FN4O5/c1-3-12(22)10(21)13(14,4-19)23-11(12)18-5-15-7-8(18)16-6(2)17-9(7)20/h1,5,10-11,19,21-22H,4H2,2H3,(H,16,17,20)/t10-,11+,12+,13+/m0/s1 |
| InChIKey | ULZNAIYQAHOIMI-UMSGYPCISA-N |
| XLogP | -1.66 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|