C12H17F2N4O13P3 — CID 136506727
[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 136506727) has the molecular formula C12H17F2N4O13P3 and a molecular weight of 556.20 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136506727 |
| Molecular Formula | C12H17F2N4O13P3 |
| Molecular Weight | 556.20 g/mol |
| Exact Mass | 556.00 |
| IUPAC Name | [[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1nc2c(ncn2[C@@H]2O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@@]2(C)F)c(=O)[nH]1 |
| InChI | InChI=1S/C12H17F2N4O13P3/c1-5-16-7-6(8(19)17-5)15-4-18(7)10-11(2,13)9(20)12(14,29-10)3-28-33(24,25)31-34(26,27)30-32(21,22)23/h4,9-10,20H,3H2,1-2H3,(H,24,25)(H,26,27)(H,16,17,19)(H2,21,22,23)/t9-,10+,11+,12+/m0/s1 |
| InChIKey | ZAYYUQACEACADE-IRCOFANPSA-N |
| XLogP | 0.06 |
| TPSA | 252.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.20 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|