C12H19FN5O14P3 — CID 136981839
[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(fluoromethyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 136981839) has the molecular formula C12H19FN5O14P3 and a molecular weight of 569.23 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(fluoromethyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(fluoromethyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136981839 |
| Molecular Formula | C12H19FN5O14P3 |
| Molecular Weight | 569.23 g/mol |
| Exact Mass | 569.01 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(fluoromethyl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(O)[C@H](O)[C@@](CF)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C12H19FN5O14P3/c1-11(21)8(20)12(2-13,3-29-34(25,26)32-35(27,28)31-33(22,23)24)30-9(11)18-4-15-5-6(18)16-10(14)17-7(5)19/h4,8-9,20-21H,2-3H2,1H3,(H,25,26)(H,27,28)(H2,22,23,24)(H3,14,16,17,19)/t8-,9+,11+,12+/m0/s1 |
| InChIKey | QJWXPQZVRLRIPW-LUTQBAROSA-N |
| XLogP | -1.61 |
| TPSA | 299.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.23 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|