C13H22N5O14P3 — CID 155013595
[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methoxy-2,4-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 155013595) has the molecular formula C13H22N5O14P3 and a molecular weight of 565.26 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methoxy-2,4-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methoxy-2,4-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155013595 |
| Molecular Formula | C13H22N5O14P3 |
| Molecular Weight | 565.26 g/mol |
| Exact Mass | 565.04 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methoxy-2,4-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CO[C@@]1(C)[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@](C)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C13H22N5O14P3/c1-12(4-29-34(24,25)32-35(26,27)31-33(21,22)23)9(20)13(2,28-3)10(30-12)18-5-15-6-7(18)16-11(14)17-8(6)19/h5,9-10,20H,4H2,1-3H3,(H,24,25)(H,26,27)(H2,21,22,23)(H3,14,16,17,19)/t9-,10-,12-,13-/m1/s1 |
| InChIKey | PTXQTTTWVLEBMX-FPQZTECRSA-N |
| XLogP | -0.90 |
| TPSA | 288.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.26 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|