C16H24N5O6P — CID 143605619
2-amino-9-[5-(diethoxyphosphanylmethoxy)-5-ethenyl-3-hydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 143605619) has the molecular formula C16H24N5O6P and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-amino-9-[5-(diethoxyphosphanylmethoxy)-5-ethenyl-3-hydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[5-(diethoxyphosphanylmethoxy)-5-ethenyl-3-hydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 143605619 |
| Molecular Formula | C16H24N5O6P |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-amino-9-[5-(diethoxyphosphanylmethoxy)-5-ethenyl-3-hydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | C=CC1(OCP(OCC)OCC)CC(O)C(n2cnc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C16H24N5O6P/c1-4-16(24-9-28(25-5-2)26-6-3)7-10(22)14(27-16)21-8-18-11-12(21)19-15(17)20-13(11)23/h4,8,10,14,22H,1,5-7,9H2,2-3H3,(H3,17,19,20,23) |
| InChIKey | AACFFPZVCACMQC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|