C23H29ClN6O6 — CID 135451785
2-amino-9-[(2R,3R,4R,5R)-3-[1-(4-chlorophenyl)-4-ethoxypiperidin-4-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135451785) has the molecular formula C23H29ClN6O6 and a molecular weight of 520.97 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4R,5R)-3-[1-(4-chlorophenyl)-4-ethoxypiperidin-4-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4R,5R)-3-[1-(4-chlorophenyl)-4-ethoxypiperidin-4-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135451785 |
| Molecular Formula | C23H29ClN6O6 |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-amino-9-[(2R,3R,4R,5R)-3-[1-(4-chlorophenyl)-4-ethoxypiperidin-4-yl]oxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CCOC1(O[C@@H]2[C@H](O)[C@@H](CO)O[C@H]2n2cnc3c(=O)[nH]c(N)nc32)CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H29ClN6O6/c1-2-34-23(7-9-29(10-8-23)14-5-3-13(24)4-6-14)36-18-17(32)15(11-31)35-21(18)30-12-26-16-19(30)27-22(25)28-20(16)33/h3-6,12,15,17-18,21,31-32H,2,7-11H2,1H3,(H3,25,27,28,33)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | BQUSGGLHVHMGRC-QTQZEZTPSA-N |
| XLogP | 1.02 |
| TPSA | 160.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|