C25H43N5O8Si2 — CID 135503356
[8-(2-amino-6-oxo-1H-purin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 2-methoxyacetate (PubChem CID 135503356) has the molecular formula C25H43N5O8Si2 and a molecular weight of 597.82 g/mol. Its IUPAC name is [8-(2-amino-6-oxo-1H-purin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 2-methoxyacetate.
| Compound Name | [8-(2-amino-6-oxo-1H-purin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 135503356 |
| Molecular Formula | C25H43N5O8Si2 |
| Molecular Weight | 597.82 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | [8-(2-amino-6-oxo-1H-purin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 2-methoxyacetate |
| SMILES | COCC(=O)OC1C2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OCC2OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C25H43N5O8Si2/c1-13(2)39(14(3)4)34-10-17-20(37-40(38-39,15(5)6)16(7)8)21(36-18(31)11-33-9)24(35-17)30-12-27-19-22(30)28-25(26)29-23(19)32/h12-17,20-21,24H,10-11H2,1-9H3,(H3,26,28,29,32) |
| InChIKey | OMOPLYNPZGHPQS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 162.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.82 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|