C23H39IN4O6Si2 — CID 174031410
7-[(6aR,8R,9S,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-amino-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 174031410) has the molecular formula C23H39IN4O6Si2 and a molecular weight of 650.66 g/mol. Its IUPAC name is 7-[(6aR,8R,9S,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-amino-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-[(6aR,8R,9S,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-amino-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 174031410 |
| Molecular Formula | C23H39IN4O6Si2 |
| Molecular Weight | 650.66 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | 7-[(6aR,8R,9S,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-2-amino-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3cc(I)c4c(=O)[nH]c(N)nc43)[C@@H](O)[C@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C23H39IN4O6Si2/c1-11(2)35(12(3)4)31-10-16-19(33-36(34-35,13(5)6)14(7)8)18(29)22(32-16)28-9-15(24)17-20(28)26-23(25)27-21(17)30/h9,11-14,16,18-19,22,29H,10H2,1-8H3,(H3,25,26,27,30)/t16-,18+,19+,22-/m1/s1 |
| InChIKey | AKAYFJBHHMNJBU-PGVBMLAISA-N |
| XLogP | 4.13 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|