C24H43N5O6Si2 — CID 22592794
2-[[8-(6-aminopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]oxy]ethanol (PubChem CID 22592794) has the molecular formula C24H43N5O6Si2 and a molecular weight of 553.81 g/mol. Its IUPAC name is 2-[[8-(6-aminopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]oxy]ethanol.
| Compound Name | 2-[[8-(6-aminopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]oxy]ethanol |
|---|---|
| PubChem CID | 22592794 |
| Molecular Formula | C24H43N5O6Si2 |
| Molecular Weight | 553.81 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 2-[[8-(6-aminopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]oxy]ethanol |
| SMILES | CC(C)[Si]1(C(C)C)OCC2OC(n3cnc4c(N)ncnc43)C(OCCO)C2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C24H43N5O6Si2/c1-14(2)36(15(3)4)32-11-18-20(34-37(35-36,16(5)6)17(7)8)21(31-10-9-30)24(33-18)29-13-28-19-22(25)26-12-27-23(19)29/h12-18,20-21,24,30H,9-11H2,1-8H3,(H2,25,26,27) |
| InChIKey | AMHBVCOWFWMJNP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|