C26H41N7O5SSi2 — CID 101134092
O-[(6aR,8R,9R,9aR)-8-(6-aminopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] imidazole-1-carbothioate (PubChem CID 101134092) has the molecular formula C26H41N7O5SSi2 and a molecular weight of 619.90 g/mol. Its IUPAC name is O-[(6aR,8R,9R,9aR)-8-(6-aminopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] imidazole-1-carbothioate.
| Compound Name | O-[(6aR,8R,9R,9aR)-8-(6-aminopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 101134092 |
| Molecular Formula | C26H41N7O5SSi2 |
| Molecular Weight | 619.90 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | O-[(6aR,8R,9R,9aR)-8-(6-aminopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] imidazole-1-carbothioate |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](OC(=S)n3ccnc3)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C26H41N7O5SSi2/c1-15(2)40(16(3)4)34-11-19-21(37-41(38-40,17(5)6)18(7)8)22(36-26(39)32-10-9-28-13-32)25(35-19)33-14-31-20-23(27)29-12-30-24(20)33/h9-10,12-19,21-22,25H,11H2,1-8H3,(H2,27,29,30)/t19-,21-,22-,25-/m1/s1 |
| InChIKey | CFBPAEXHHFXXTL-PTGPVQHPSA-N |
| XLogP | 4.68 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.90 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|