C33H45N7O6SSi2 — CID 88614984
O-[(6aR,8R,9S)-8-(6-benzamidopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] imidazole-1-carbothioate (PubChem CID 88614984) has the molecular formula C33H45N7O6SSi2 and a molecular weight of 724.01 g/mol. Its IUPAC name is O-[(6aR,8R,9S)-8-(6-benzamidopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] imidazole-1-carbothioate.
| Compound Name | O-[(6aR,8R,9S)-8-(6-benzamidopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 88614984 |
| Molecular Formula | C33H45N7O6SSi2 |
| Molecular Weight | 724.01 g/mol |
| Exact Mass | 723.27 |
| IUPAC Name | O-[(6aR,8R,9S)-8-(6-benzamidopurin-9-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] imidazole-1-carbothioate |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@@H](OC(=S)n3ccnc3)C2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C33H45N7O6SSi2/c1-20(2)48(21(3)4)42-16-25-27(45-49(46-48,22(5)6)23(7)8)28(44-33(47)39-15-14-34-18-39)32(43-25)40-19-37-26-29(35-17-36-30(26)40)38-31(41)24-12-10-9-11-13-24/h9-15,17-23,25,27-28,32H,16H2,1-8H3,(H,35,36,38,41)/t25-,27?,28+,32-/m1/s1 |
| InChIKey | NJLNSYKDPCJKEQ-FGALSUIOSA-N |
| XLogP | 6.35 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.01 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|