C26H47N5O5Si2 — CID 171422383
9-[(6aR,8R,9S)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-N-propan-2-ylpurin-6-amine (PubChem CID 171422383) has the molecular formula C26H47N5O5Si2 and a molecular weight of 565.86 g/mol. Its IUPAC name is 9-[(6aR,8R,9S)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-N-propan-2-ylpurin-6-amine.
| Compound Name | 9-[(6aR,8R,9S)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-N-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 171422383 |
| Molecular Formula | C26H47N5O5Si2 |
| Molecular Weight | 565.86 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | 9-[(6aR,8R,9S)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-N-propan-2-ylpurin-6-amine |
| SMILES | CO[C@H]1C2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O[C@H]1n1cnc2c(NC(C)C)ncnc21 |
| InChI | InChI=1S/C26H47N5O5Si2/c1-15(2)30-24-21-25(28-13-27-24)31(14-29-21)26-23(32-11)22-20(34-26)12-33-37(16(3)4,17(5)6)36-38(35-22,18(7)8)19(9)10/h13-20,22-23,26H,12H2,1-11H3,(H,27,28,30)/t20-,22?,23+,26-/m1/s1 |
| InChIKey | DDZLUPCAEYXJOH-WVBWZXASSA-N |
| XLogP | 5.52 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.86 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|