C32H49N5O7Si2 — CID 156679969
N-[9-[(6aR,8R,9S,9aS)-9-(2-hydroxyethyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]-4-methoxybenzamide (PubChem CID 156679969) has the molecular formula C32H49N5O7Si2 and a molecular weight of 671.94 g/mol. Its IUPAC name is N-[9-[(6aR,8R,9S,9aS)-9-(2-hydroxyethyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]-4-methoxybenzamide.
| Compound Name | N-[9-[(6aR,8R,9S,9aS)-9-(2-hydroxyethyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 156679969 |
| Molecular Formula | C32H49N5O7Si2 |
| Molecular Weight | 671.94 g/mol |
| Exact Mass | 671.32 |
| IUPAC Name | N-[9-[(6aR,8R,9S,9aS)-9-(2-hydroxyethyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]purin-6-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ncnc3c2ncn3[C@@H]2O[C@@H]3CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]3[C@@H]2CCO)cc1 |
| InChI | InChI=1S/C32H49N5O7Si2/c1-19(2)45(20(3)4)41-16-26-28(43-46(44-45,21(5)6)22(7)8)25(14-15-38)32(42-26)37-18-35-27-29(33-17-34-30(27)37)36-31(39)23-10-12-24(40-9)13-11-23/h10-13,17-22,25-26,28,32,38H,14-16H2,1-9H3,(H,33,34,36,39)/t25-,26+,28-,32+/m0/s1 |
| InChIKey | QOYYCBBYMICJHV-XHAJMTSNSA-N |
| XLogP | 5.94 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.94 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|